C19H26ClN3O3 — CID 51120135
1-[3-[(5,7-dimethoxyquinolin-3-yl)methylamino]propyl]pyrrolidin-2-one;hydrochloride (PubChem CID 51120135) has the molecular formula C19H26ClN3O3 and a molecular weight of 379.89 g/mol. Its IUPAC name is 1-[3-[(5,7-dimethoxyquinolin-3-yl)methylamino]propyl]pyrrolidin-2-one;hydrochloride.
| Compound Name | 1-[3-[(5,7-dimethoxyquinolin-3-yl)methylamino]propyl]pyrrolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 51120135 |
| Molecular Formula | C19H26ClN3O3 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 1-[3-[(5,7-dimethoxyquinolin-3-yl)methylamino]propyl]pyrrolidin-2-one;hydrochloride |
| SMILES | COc1cc(OC)c2cc(CNCCCN3CCCC3=O)cnc2c1.Cl |
| InChI | InChI=1S/C19H25N3O3.ClH/c1-24-15-10-17-16(18(11-15)25-2)9-14(13-21-17)12-20-6-4-8-22-7-3-5-19(22)23;/h9-11,13,20H,3-8,12H2,1-2H3;1H |
| InChIKey | UMDPVKPQTCCTDG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|