C19H24N4O4 — CID 51124920
1-[(3,4-dimethoxyphenyl)methyl]-3-(2-morpholin-4-yl-3-pyridinyl)urea (PubChem CID 51124920) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-3-(2-morpholin-4-yl-3-pyridinyl)urea.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-(2-morpholin-4-yl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 51124920 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-(2-morpholin-4-yl-3-pyridinyl)urea |
| SMILES | COc1ccc(CNC(=O)Nc2cccnc2N2CCOCC2)cc1OC |
| InChI | InChI=1S/C19H24N4O4/c1-25-16-6-5-14(12-17(16)26-2)13-21-19(24)22-15-4-3-7-20-18(15)23-8-10-27-11-9-23/h3-7,12H,8-11,13H2,1-2H3,(H2,21,22,24) |
| InChIKey | VXXFYZBAXCYXID-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |