C25H22F2N2O3 — CID 51125015
3,5-difluoro-N-[3-hydroxy-4-(4-phenylpiperidine-1-carbonyl)phenyl]benzamide (PubChem CID 51125015) has the molecular formula C25H22F2N2O3 and a molecular weight of 436.46 g/mol. Its IUPAC name is 3,5-difluoro-N-[3-hydroxy-4-(4-phenylpiperidine-1-carbonyl)phenyl]benzamide.
| Compound Name | 3,5-difluoro-N-[3-hydroxy-4-(4-phenylpiperidine-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 51125015 |
| Molecular Formula | C25H22F2N2O3 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 3,5-difluoro-N-[3-hydroxy-4-(4-phenylpiperidine-1-carbonyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(C(=O)N2CCC(c3ccccc3)CC2)c(O)c1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C25H22F2N2O3/c26-19-12-18(13-20(27)14-19)24(31)28-21-6-7-22(23(30)15-21)25(32)29-10-8-17(9-11-29)16-4-2-1-3-5-16/h1-7,12-15,17,30H,8-11H2,(H,28,31) |
| InChIKey | WOEVKCAXGPVMKW-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |