C20H22N2O3S — CID 51128424
4-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(1,1-dioxothiolan-3-yl)benzamide (PubChem CID 51128424) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is 4-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(1,1-dioxothiolan-3-yl)benzamide.
| Compound Name | 4-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(1,1-dioxothiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 51128424 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 4-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(1,1-dioxothiolan-3-yl)benzamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1ccc(N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C20H22N2O3S/c23-20(21-18-10-12-26(24,25)14-18)16-5-7-19(8-6-16)22-11-9-15-3-1-2-4-17(15)13-22/h1-8,18H,9-14H2,(H,21,23) |
| InChIKey | BQRPTROFAPRSMT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |