C20H25N3O6S2 — CID 51130554
N-(2-hydroxyethyl)-3-[(4-piperidin-1-ylsulfonylphenyl)sulfonylamino]benzamide (PubChem CID 51130554) has the molecular formula C20H25N3O6S2 and a molecular weight of 467.57 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-3-[(4-piperidin-1-ylsulfonylphenyl)sulfonylamino]benzamide.
| Compound Name | N-(2-hydroxyethyl)-3-[(4-piperidin-1-ylsulfonylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 51130554 |
| Molecular Formula | C20H25N3O6S2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | N-(2-hydroxyethyl)-3-[(4-piperidin-1-ylsulfonylphenyl)sulfonylamino]benzamide |
| SMILES | O=C(NCCO)c1cccc(NS(=O)(=O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C20H25N3O6S2/c24-14-11-21-20(25)16-5-4-6-17(15-16)22-30(26,27)18-7-9-19(10-8-18)31(28,29)23-12-2-1-3-13-23/h4-10,15,22,24H,1-3,11-14H2,(H,21,25) |
| InChIKey | UFOXNKBJSJAOFH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |