C25H24ClN3O4 — CID 5114199
4-[3-[(2-chloro-7-methylquinolin-3-yl)methyl]-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoic acid (PubChem CID 5114199) has the molecular formula C25H24ClN3O4 and a molecular weight of 465.94 g/mol. Its IUPAC name is 4-[3-[(2-chloro-7-methylquinolin-3-yl)methyl]-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoic acid.
| Compound Name | 4-[3-[(2-chloro-7-methylquinolin-3-yl)methyl]-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 5114199 |
| Molecular Formula | C25H24ClN3O4 |
| Molecular Weight | 465.94 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 4-[3-[(2-chloro-7-methylquinolin-3-yl)methyl]-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoic acid |
| SMILES | COc1ccc(C2=NN(C(=O)CCC(=O)O)C(Cc3cc4ccc(C)cc4nc3Cl)C2)cc1 |
| InChI | InChI=1S/C25H24ClN3O4/c1-15-3-4-17-12-18(25(26)27-21(17)11-15)13-19-14-22(16-5-7-20(33-2)8-6-16)28-29(19)23(30)9-10-24(31)32/h3-8,11-12,19H,9-10,13-14H2,1-2H3,(H,31,32) |
| InChIKey | TTZSRLUREQAEQK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.94 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|