C22H21NO2S — CID 51185162
N-(2,2-diphenylethyl)-4-methylsulfinylbenzamide (PubChem CID 51185162) has the molecular formula C22H21NO2S and a molecular weight of 363.48 g/mol. Its IUPAC name is N-(2,2-diphenylethyl)-4-methylsulfinylbenzamide.
| Compound Name | N-(2,2-diphenylethyl)-4-methylsulfinylbenzamide |
|---|---|
| PubChem CID | 51185162 |
| Molecular Formula | C22H21NO2S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | N-(2,2-diphenylethyl)-4-methylsulfinylbenzamide |
| SMILES | CS(=O)c1ccc(C(=O)NCC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21NO2S/c1-26(25)20-14-12-19(13-15-20)22(24)23-16-21(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-15,21H,16H2,1H3,(H,23,24) |
| InChIKey | CTDWYVVQITXGTA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |