C17H20N2O5S — CID 51230938
(2,4-dimethylphenyl) 4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxylate (PubChem CID 51230938) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is (2,4-dimethylphenyl) 4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxylate.
| Compound Name | (2,4-dimethylphenyl) 4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 51230938 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (2,4-dimethylphenyl) 4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxylate |
| SMILES | Cc1ccc(OC(=O)c2cc(S(=O)(=O)N3CCOCC3)c[nH]2)c(C)c1 |
| InChI | InChI=1S/C17H20N2O5S/c1-12-3-4-16(13(2)9-12)24-17(20)15-10-14(11-18-15)25(21,22)19-5-7-23-8-6-19/h3-4,9-11,18H,5-8H2,1-2H3 |
| InChIKey | IXJOJHVLXWCILC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|