C19H22N2O6S3 — CID 55413631
[4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxylate (PubChem CID 55413631) has the molecular formula C19H22N2O6S3 and a molecular weight of 470.59 g/mol. Its IUPAC name is [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxylate.
| Compound Name | [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 55413631 |
| Molecular Formula | C19H22N2O6S3 |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxylate |
| SMILES | COc1cc(C2SCCS2)ccc1OC(=O)c1cc(S(=O)(=O)N2CCOCC2)c[nH]1 |
| InChI | InChI=1S/C19H22N2O6S3/c1-25-17-10-13(19-28-8-9-29-19)2-3-16(17)27-18(22)15-11-14(12-20-15)30(23,24)21-4-6-26-7-5-21/h2-3,10-12,19-20H,4-9H2,1H3 |
| InChIKey | YCOCQQDDZIUPPS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 97.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|