C15H15Cl2N3O5S — CID 56528465
(3,6-dichloro-2-pyridinyl)methyl 4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxylate (PubChem CID 56528465) has the molecular formula C15H15Cl2N3O5S and a molecular weight of 420.27 g/mol. Its IUPAC name is (3,6-dichloro-2-pyridinyl)methyl 4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxylate.
| Compound Name | (3,6-dichloro-2-pyridinyl)methyl 4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 56528465 |
| Molecular Formula | C15H15Cl2N3O5S |
| Molecular Weight | 420.27 g/mol |
| Exact Mass | 419.01 |
| IUPAC Name | (3,6-dichloro-2-pyridinyl)methyl 4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxylate |
| SMILES | O=C(OCc1nc(Cl)ccc1Cl)c1cc(S(=O)(=O)N2CCOCC2)c[nH]1 |
| InChI | InChI=1S/C15H15Cl2N3O5S/c16-11-1-2-14(17)19-13(11)9-25-15(21)12-7-10(8-18-12)26(22,23)20-3-5-24-6-4-20/h1-2,7-8,18H,3-6,9H2 |
| InChIKey | XZROCSFMQDUNRU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 101.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|