C17H17F3N2O5S — CID 46535434
[2-(trifluoromethyl)phenyl]methyl 4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxylate (PubChem CID 46535434) has the molecular formula C17H17F3N2O5S and a molecular weight of 418.39 g/mol. Its IUPAC name is [2-(trifluoromethyl)phenyl]methyl 4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxylate.
| Compound Name | [2-(trifluoromethyl)phenyl]methyl 4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 46535434 |
| Molecular Formula | C17H17F3N2O5S |
| Molecular Weight | 418.39 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | [2-(trifluoromethyl)phenyl]methyl 4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxylate |
| SMILES | O=C(OCc1ccccc1C(F)(F)F)c1cc(S(=O)(=O)N2CCOCC2)c[nH]1 |
| InChI | InChI=1S/C17H17F3N2O5S/c18-17(19,20)14-4-2-1-3-12(14)11-27-16(23)15-9-13(10-21-15)28(24,25)22-5-7-26-8-6-22/h1-4,9-10,21H,5-8,11H2 |
| InChIKey | QIYNMTYZTPEDFR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |