C25H18N2O3S — CID 5124453
N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-(2-oxochromen-3-yl)benzamide (PubChem CID 5124453) has the molecular formula C25H18N2O3S and a molecular weight of 426.50 g/mol. Its IUPAC name is N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-(2-oxochromen-3-yl)benzamide.
| Compound Name | N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-(2-oxochromen-3-yl)benzamide |
|---|---|
| PubChem CID | 5124453 |
| Molecular Formula | C25H18N2O3S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-(2-oxochromen-3-yl)benzamide |
| SMILES | Cc1cc(C)c2nc(NC(=O)c3cccc(-c4cc5ccccc5oc4=O)c3)sc2c1 |
| InChI | InChI=1S/C25H18N2O3S/c1-14-10-15(2)22-21(11-14)31-25(26-22)27-23(28)18-8-5-7-16(12-18)19-13-17-6-3-4-9-20(17)30-24(19)29/h3-13H,1-2H3,(H,26,27,28) |
| InChIKey | SKWGULXXLMCOGA-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|