C18H13F3N2O3 — CID 51253530
N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2H-chromene-3-carboxamide (PubChem CID 51253530) has the molecular formula C18H13F3N2O3 and a molecular weight of 362.31 g/mol. Its IUPAC name is N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2H-chromene-3-carboxamide.
| Compound Name | N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 51253530 |
| Molecular Formula | C18H13F3N2O3 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2H-chromene-3-carboxamide |
| SMILES | O=C(CNC(=O)C1=Cc2ccccc2OC1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H13F3N2O3/c19-12-5-6-13(17(21)16(12)20)23-15(24)8-22-18(25)11-7-10-3-1-2-4-14(10)26-9-11/h1-7H,8-9H2,(H,22,25)(H,23,24) |
| InChIKey | FPOHJZJLNLHPPA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|