C22H14BrF3N2O3 — CID 55533610
2-(4-bromobenzoyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide (PubChem CID 55533610) has the molecular formula C22H14BrF3N2O3 and a molecular weight of 491.26 g/mol. Its IUPAC name is 2-(4-bromobenzoyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide.
| Compound Name | 2-(4-bromobenzoyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 55533610 |
| Molecular Formula | C22H14BrF3N2O3 |
| Molecular Weight | 491.26 g/mol |
| Exact Mass | 490.01 |
| IUPAC Name | 2-(4-bromobenzoyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1C(=O)c1ccc(Br)cc1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C22H14BrF3N2O3/c23-13-7-5-12(6-8-13)21(30)14-3-1-2-4-15(14)22(31)27-11-18(29)28-17-10-9-16(24)19(25)20(17)26/h1-10H,11H2,(H,27,31)(H,28,29) |
| InChIKey | QFTLONVXDHPGDX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.26 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|