C16H15BrF3N3O2 — CID 78895716
4-bromo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-1-propan-2-ylpyrrole-2-carboxamide (PubChem CID 78895716) has the molecular formula C16H15BrF3N3O2 and a molecular weight of 418.21 g/mol. Its IUPAC name is 4-bromo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-1-propan-2-ylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-1-propan-2-ylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 78895716 |
| Molecular Formula | C16H15BrF3N3O2 |
| Molecular Weight | 418.21 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | 4-bromo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-1-propan-2-ylpyrrole-2-carboxamide |
| SMILES | CC(C)n1cc(Br)cc1C(=O)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H15BrF3N3O2/c1-8(2)23-7-9(17)5-12(23)16(25)21-6-13(24)22-11-4-3-10(18)14(19)15(11)20/h3-5,7-8H,6H2,1-2H3,(H,21,25)(H,22,24) |
| InChIKey | FCZLJRYCGXFERM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.21 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|