C22H38N2O3S — CID 512855
N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]cyclohexanecarboxamide (PubChem CID 512855) has the molecular formula C22H38N2O3S and a molecular weight of 410.62 g/mol. Its IUPAC name is N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 512855 |
| Molecular Formula | C22H38N2O3S |
| Molecular Weight | 410.62 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]cyclohexanecarboxamide |
| SMILES | CCCCCCCCCN1C(=O)CC(SCCNC(=O)C2CCCCC2)C1=O |
| InChI | InChI=1S/C22H38N2O3S/c1-2-3-4-5-6-7-11-15-24-20(25)17-19(22(24)27)28-16-14-23-21(26)18-12-9-8-10-13-18/h18-19H,2-17H2,1H3,(H,23,26) |
| InChIKey | IWDOZHJZVTUCED-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.62 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|