C39H53FN2O3 — CID 5128831
cyclohexyl-[5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone (PubChem CID 5128831) has the molecular formula C39H53FN2O3 and a molecular weight of 616.86 g/mol. Its IUPAC name is cyclohexyl-[5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone.
| Compound Name | cyclohexyl-[5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
|---|---|
| PubChem CID | 5128831 |
| Molecular Formula | C39H53FN2O3 |
| Molecular Weight | 616.86 g/mol |
| Exact Mass | 616.40 |
| IUPAC Name | cyclohexyl-[5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)C4CCCCC4)=C3)C2CCC2(C)C1CCC2(O)CN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C39H53FN2O3/c1-35-15-12-30(43)24-37(35)18-19-39(31(25-37)34(44)27-6-4-3-5-7-27)32(35)13-16-36(2)33(39)14-17-38(36,45)26-41-20-22-42(23-21-41)29-10-8-28(40)9-11-29/h8-11,18-19,25,27,30,32-33,43,45H,3-7,12-17,20-24,26H2,1-2H3 |
| InChIKey | XISFFUCUYGLEDY-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.86 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|