C20H19N3O2S — CID 51328068
N-[3-(2-propan-2-yliminopyridine-1-carbonyl)phenyl]thiophene-2-carboxamide (PubChem CID 51328068) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is N-[3-(2-propan-2-yliminopyridine-1-carbonyl)phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-(2-propan-2-yliminopyridine-1-carbonyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 51328068 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | N-[3-(2-propan-2-yliminopyridine-1-carbonyl)phenyl]thiophene-2-carboxamide |
| SMILES | CC(C)/N=c1\ccccn1C(=O)c1cccc(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C20H19N3O2S/c1-14(2)21-18-10-3-4-11-23(18)20(25)15-7-5-8-16(13-15)22-19(24)17-9-6-12-26-17/h3-14H,1-2H3,(H,22,24)/b21-18+ |
| InChIKey | JQJVBEKYIZEIGW-DYTRJAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |