C21H25N5O3 — CID 51336102
2-(benzotriazol-1-yl)-N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]acetamide (PubChem CID 51336102) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]acetamide.
| Compound Name | 2-(benzotriazol-1-yl)-N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]acetamide |
|---|---|
| PubChem CID | 51336102 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 2-(benzotriazol-1-yl)-N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]acetamide |
| SMILES | COc1ccc(C(CNC(=O)Cn2nnc3ccccc32)N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H25N5O3/c1-28-17-8-6-16(7-9-17)20(25-10-12-29-13-11-25)14-22-21(27)15-26-19-5-3-2-4-18(19)23-24-26/h2-9,20H,10-15H2,1H3,(H,22,27) |
| InChIKey | HUTJUFXUSSEQQZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |