C49H45N3O8 — CID 51341457
[2-methoxy-4-[2-(methylamino)-2-oxoethoxy]phenyl]methyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(tritylamino)butanoate (PubChem CID 51341457) has the molecular formula C49H45N3O8 and a molecular weight of 803.91 g/mol. Its IUPAC name is [2-methoxy-4-[2-(methylamino)-2-oxoethoxy]phenyl]methyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(tritylamino)butanoate.
| Compound Name | [2-methoxy-4-[2-(methylamino)-2-oxoethoxy]phenyl]methyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(tritylamino)butanoate |
|---|---|
| PubChem CID | 51341457 |
| Molecular Formula | C49H45N3O8 |
| Molecular Weight | 803.91 g/mol |
| Exact Mass | 803.32 |
| IUPAC Name | [2-methoxy-4-[2-(methylamino)-2-oxoethoxy]phenyl]methyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(tritylamino)butanoate |
| SMILES | CNC(=O)COc1ccc(COC(=O)[C@@H](CC(=O)NC(c2ccccc2)(c2ccccc2)c2ccccc2)NC(=O)OCC2c3ccccc3-c3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C49H45N3O8/c1-50-46(54)32-58-37-27-26-33(44(28-37)57-2)30-59-47(55)43(51-48(56)60-31-42-40-24-14-12-22-38(40)39-23-13-15-25-41(39)42)29-45(53)52-49(34-16-6-3-7-17-34,35-18-8-4-9-19-35)36-20-10-5-11-21-36/h3-28,42-43H,29-32H2,1-2H3,(H,50,54)(H,51,56)(H,52,53)/t43-/m1/s1 |
| InChIKey | QSWLZLSECPOPHL-VZUYHUTRSA-N |
| XLogP | 7.27 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.91 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|