C24H19BrN2O2S — CID 5134174
N-[4,5-bis(4-methylphenyl)-1,3-thiazol-2-yl]-3-(5-bromofuran-2-yl)prop-2-enamide (PubChem CID 5134174) has the molecular formula C24H19BrN2O2S and a molecular weight of 479.40 g/mol. Its IUPAC name is N-[4,5-bis(4-methylphenyl)-1,3-thiazol-2-yl]-3-(5-bromofuran-2-yl)prop-2-enamide.
| Compound Name | N-[4,5-bis(4-methylphenyl)-1,3-thiazol-2-yl]-3-(5-bromofuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 5134174 |
| Molecular Formula | C24H19BrN2O2S |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | N-[4,5-bis(4-methylphenyl)-1,3-thiazol-2-yl]-3-(5-bromofuran-2-yl)prop-2-enamide |
| SMILES | Cc1ccc(-c2nc(NC(=O)C=Cc3ccc(Br)o3)sc2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H19BrN2O2S/c1-15-3-7-17(8-4-15)22-23(18-9-5-16(2)6-10-18)30-24(27-22)26-21(28)14-12-19-11-13-20(25)29-19/h3-14H,1-2H3,(H,26,27,28) |
| InChIKey | GCYDDTGRFDQRPF-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|