C37H34N4O5 — CID 51346499
ethyl 6-(1-methoxy-1-oxopropan-2-ylidene)-7-(4-methoxyphenyl)-1,3,4-triphenyl-1,2,4,7-tetrazaspiro[4.4]nona-2,8-diene-9-carboxylate (PubChem CID 51346499) has the molecular formula C37H34N4O5 and a molecular weight of 614.70 g/mol. Its IUPAC name is ethyl 6-(1-methoxy-1-oxopropan-2-ylidene)-7-(4-methoxyphenyl)-1,3,4-triphenyl-1,2,4,7-tetrazaspiro[4.4]nona-2,8-diene-9-carboxylate.
| Compound Name | ethyl 6-(1-methoxy-1-oxopropan-2-ylidene)-7-(4-methoxyphenyl)-1,3,4-triphenyl-1,2,4,7-tetrazaspiro[4.4]nona-2,8-diene-9-carboxylate |
|---|---|
| PubChem CID | 51346499 |
| Molecular Formula | C37H34N4O5 |
| Molecular Weight | 614.70 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | ethyl 6-(1-methoxy-1-oxopropan-2-ylidene)-7-(4-methoxyphenyl)-1,3,4-triphenyl-1,2,4,7-tetrazaspiro[4.4]nona-2,8-diene-9-carboxylate |
| SMILES | CCOC(=O)C1=CN(c2ccc(OC)cc2)C(=C(C)C(=O)OC)C12N(c1ccccc1)N=C(c1ccccc1)N2c1ccccc1 |
| InChI | InChI=1S/C37H34N4O5/c1-5-46-36(43)32-25-39(28-21-23-31(44-3)24-22-28)33(26(2)35(42)45-4)37(32)40(29-17-11-7-12-18-29)34(27-15-9-6-10-16-27)38-41(37)30-19-13-8-14-20-30/h6-25H,5H2,1-4H3 |
| InChIKey | HVSLATAEDIZQEF-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 83.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.70 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|