C13H14ClN5O — CID 51346899
1-[(4-chlorophenyl)methyl]-N-(diaminomethylidene)-5-methylimidazole-4-carboxamide (PubChem CID 51346899) has the molecular formula C13H14ClN5O and a molecular weight of 291.74 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-N-(diaminomethylidene)-5-methylimidazole-4-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-N-(diaminomethylidene)-5-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 51346899 |
| Molecular Formula | C13H14ClN5O |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-N-(diaminomethylidene)-5-methylimidazole-4-carboxamide |
| SMILES | Cc1c(C(=O)N=C(N)N)ncn1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H14ClN5O/c1-8-11(12(20)18-13(15)16)17-7-19(8)6-9-2-4-10(14)5-3-9/h2-5,7H,6H2,1H3,(H4,15,16,18,20) |
| InChIKey | MBFRJCJPZMFFMU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|