C23H19BrFN3O3 — CID 5135445
N'-[(3-bromo-4-phenylmethoxyphenyl)methylideneamino]-N-(2-fluorophenyl)propanediamide (PubChem CID 5135445) has the molecular formula C23H19BrFN3O3 and a molecular weight of 484.33 g/mol. Its IUPAC name is N'-[(3-bromo-4-phenylmethoxyphenyl)methylideneamino]-N-(2-fluorophenyl)propanediamide.
| Compound Name | N'-[(3-bromo-4-phenylmethoxyphenyl)methylideneamino]-N-(2-fluorophenyl)propanediamide |
|---|---|
| PubChem CID | 5135445 |
| Molecular Formula | C23H19BrFN3O3 |
| Molecular Weight | 484.33 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | N'-[(3-bromo-4-phenylmethoxyphenyl)methylideneamino]-N-(2-fluorophenyl)propanediamide |
| SMILES | O=C(CC(=O)Nc1ccccc1F)NN=Cc1ccc(OCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C23H19BrFN3O3/c24-18-12-17(10-11-21(18)31-15-16-6-2-1-3-7-16)14-26-28-23(30)13-22(29)27-20-9-5-4-8-19(20)25/h1-12,14H,13,15H2,(H,27,29)(H,28,30) |
| InChIKey | BJAJVMZLXIOHCB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.33 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|