C45H42Cl3N9O6 — CID 51355816
2-[4-[3,5-bis[4-[(4-butoxy-6-chloro-1,3,5-triazin-2-yl)oxy]phenyl]phenyl]phenoxy]-4-butoxy-6-chloro-1,3,5-triazine (PubChem CID 51355816) has the molecular formula C45H42Cl3N9O6 and a molecular weight of 911.25 g/mol. Its IUPAC name is 2-[4-[3,5-bis[4-[(4-butoxy-6-chloro-1,3,5-triazin-2-yl)oxy]phenyl]phenyl]phenoxy]-4-butoxy-6-chloro-1,3,5-triazine.
| Compound Name | 2-[4-[3,5-bis[4-[(4-butoxy-6-chloro-1,3,5-triazin-2-yl)oxy]phenyl]phenyl]phenoxy]-4-butoxy-6-chloro-1,3,5-triazine |
|---|---|
| PubChem CID | 51355816 |
| Molecular Formula | C45H42Cl3N9O6 |
| Molecular Weight | 911.25 g/mol |
| Exact Mass | 909.23 |
| IUPAC Name | 2-[4-[3,5-bis[4-[(4-butoxy-6-chloro-1,3,5-triazin-2-yl)oxy]phenyl]phenyl]phenoxy]-4-butoxy-6-chloro-1,3,5-triazine |
| SMILES | CCCCOc1nc(Cl)nc(Oc2ccc(-c3cc(-c4ccc(Oc5nc(Cl)nc(OCCCC)n5)cc4)cc(-c4ccc(Oc5nc(Cl)nc(OCCCC)n5)cc4)c3)cc2)n1 |
| InChI | InChI=1S/C45H42Cl3N9O6/c1-4-7-22-58-40-49-37(46)52-43(55-40)61-34-16-10-28(11-17-34)31-25-32(29-12-18-35(19-13-29)62-44-53-38(47)50-41(56-44)59-23-8-5-2)27-33(26-31)30-14-20-36(21-15-30)63-45-54-39(48)51-42(57-45)60-24-9-6-3/h10-21,25-27H,4-9,22-24H2,1-3H3 |
| InChIKey | HZNUTVPBSCNASV-UHFFFAOYSA-N |
| XLogP | 12.12 |
| TPSA | 171.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.25 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|