C19H27FN2 — CID 51356859
(1R,9R,10R)-17-(3-fluoropropyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine (PubChem CID 51356859) has the molecular formula C19H27FN2 and a molecular weight of 302.44 g/mol. Its IUPAC name is (1R,9R,10R)-17-(3-fluoropropyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine.
| Compound Name | (1R,9R,10R)-17-(3-fluoropropyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine |
|---|---|
| PubChem CID | 51356859 |
| Molecular Formula | C19H27FN2 |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (1R,9R,10R)-17-(3-fluoropropyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine |
| SMILES | Nc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(CCCF)CC3 |
| InChI | InChI=1S/C19H27FN2/c20-9-3-10-22-11-8-19-7-2-1-4-16(19)18(22)12-14-5-6-15(21)13-17(14)19/h5-6,13,16,18H,1-4,7-12,21H2/t16-,18+,19+/m0/s1 |
| InChIKey | PAHGBJQJOHNEAG-QXAKKESOSA-N |
| XLogP | 3.69 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|