C29H38N2O7 — CID 6916704
(1S,9S,10R)-17-(3-anilinopropyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol;(2R,3R)-2,3-dihydroxybutanedioic acid (PubChem CID 6916704) has the molecular formula C29H38N2O7 and a molecular weight of 526.63 g/mol. Its IUPAC name is (1S,9S,10R)-17-(3-anilinopropyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol;(2R,3R)-2,3-dihydroxybutanedioic acid.
| Compound Name | (1S,9S,10R)-17-(3-anilinopropyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol;(2R,3R)-2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 6916704 |
| Molecular Formula | C29H38N2O7 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | (1S,9S,10R)-17-(3-anilinopropyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol;(2R,3R)-2,3-dihydroxybutanedioic acid |
| SMILES | O=C(O)[C@H](O)[C@@H](O)C(=O)O.Oc1ccc2c(c1)[C@]13CCCC[C@H]1[C@H](C2)N(CCCNc1ccccc1)CC3 |
| InChI | InChI=1S/C25H32N2O.C4H6O6/c28-21-11-10-19-17-24-22-9-4-5-12-25(22,23(19)18-21)13-16-27(24)15-6-14-26-20-7-2-1-3-8-20;5-1(3(7)8)2(6)4(9)10/h1-3,7-8,10-11,18,22,24,26,28H,4-6,9,12-17H2;1-2,5-6H,(H,7,8)(H,9,10)/t22-,24-,25-;1-,2-/m01/s1 |
| InChIKey | DSZWSFATCDIJEH-SUJAHKAKSA-N |
| XLogP | 2.83 |
| TPSA | 150.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|