C9H16F2N2O — CID 51357995
1-[4-(2,2-difluoropropyl)piperazin-1-yl]ethanone (PubChem CID 51357995) has the molecular formula C9H16F2N2O and a molecular weight of 206.24 g/mol. Its IUPAC name is 1-[4-(2,2-difluoropropyl)piperazin-1-yl]ethanone.
| Compound Name | 1-[4-(2,2-difluoropropyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 51357995 |
| Molecular Formula | C9H16F2N2O |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 1-[4-(2,2-difluoropropyl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(CC(C)(F)F)CC1 |
| InChI | InChI=1S/C9H16F2N2O/c1-8(14)13-5-3-12(4-6-13)7-9(2,10)11/h3-7H2,1-2H3 |
| InChIKey | LTXNHYBUGKTXEN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |