C25H31ClN2O5S — CID 51359572
tert-butyl (2S)-2-[[(3S,4S)-8-chloro-3-methyl-1,1-dioxo-4-phenyl-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]pyrrolidine-1-carboxylate (PubChem CID 51359572) has the molecular formula C25H31ClN2O5S and a molecular weight of 507.05 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(3S,4S)-8-chloro-3-methyl-1,1-dioxo-4-phenyl-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[(3S,4S)-8-chloro-3-methyl-1,1-dioxo-4-phenyl-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 51359572 |
| Molecular Formula | C25H31ClN2O5S |
| Molecular Weight | 507.05 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | tert-butyl (2S)-2-[[(3S,4S)-8-chloro-3-methyl-1,1-dioxo-4-phenyl-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]pyrrolidine-1-carboxylate |
| SMILES | C[C@H]1[C@H](c2ccccc2)Oc2ccc(Cl)cc2S(=O)(=O)N1C[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H31ClN2O5S/c1-17-23(18-9-6-5-7-10-18)32-21-13-12-19(26)15-22(21)34(30,31)28(17)16-20-11-8-14-27(20)24(29)33-25(2,3)4/h5-7,9-10,12-13,15,17,20,23H,8,11,14,16H2,1-4H3/t17-,20-,23+/m0/s1 |
| InChIKey | CVEUZVKMNDNYMR-KPDCDPCYSA-N |
| XLogP | 5.25 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.05 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |