C15H21NO5S — CID 51359630
7-[(4-methoxyphenoxy)methyl]-5-prop-2-enyl-1,4,5-oxathiazepane 4,4-dioxide (PubChem CID 51359630) has the molecular formula C15H21NO5S and a molecular weight of 327.40 g/mol. Its IUPAC name is 7-[(4-methoxyphenoxy)methyl]-5-prop-2-enyl-1,4,5-oxathiazepane 4,4-dioxide.
| Compound Name | 7-[(4-methoxyphenoxy)methyl]-5-prop-2-enyl-1,4,5-oxathiazepane 4,4-dioxide |
|---|---|
| PubChem CID | 51359630 |
| Molecular Formula | C15H21NO5S |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 7-[(4-methoxyphenoxy)methyl]-5-prop-2-enyl-1,4,5-oxathiazepane 4,4-dioxide |
| SMILES | C=CCN1CC(COc2ccc(OC)cc2)OCCS1(=O)=O |
| InChI | InChI=1S/C15H21NO5S/c1-3-8-16-11-15(20-9-10-22(16,17)18)12-21-14-6-4-13(19-2)5-7-14/h3-7,15H,1,8-12H2,2H3 |
| InChIKey | BXUAHNYOXOEBBK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|