C18H13F4N3O — CID 51361100
N-[(4-fluorophenyl)methyl]-4-phenyl-2-(trifluoromethyl)-1H-imidazole-5-carboxamide (PubChem CID 51361100) has the molecular formula C18H13F4N3O and a molecular weight of 363.31 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-4-phenyl-2-(trifluoromethyl)-1H-imidazole-5-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-4-phenyl-2-(trifluoromethyl)-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 51361100 |
| Molecular Formula | C18H13F4N3O |
| Molecular Weight | 363.31 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-4-phenyl-2-(trifluoromethyl)-1H-imidazole-5-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1[nH]c(C(F)(F)F)nc1-c1ccccc1 |
| InChI | InChI=1S/C18H13F4N3O/c19-13-8-6-11(7-9-13)10-23-16(26)15-14(12-4-2-1-3-5-12)24-17(25-15)18(20,21)22/h1-9H,10H2,(H,23,26)(H,24,25) |
| InChIKey | LSIQQMIJWOPSQV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.31 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |