C17H22ClN5O3 — CID 51362206
4-[2-(5-chloro-1H-indole-2-carbonyl)hydrazinyl]-N-[2-(dimethylamino)ethyl]-4-oxobutanamide (PubChem CID 51362206) has the molecular formula C17H22ClN5O3 and a molecular weight of 379.85 g/mol. Its IUPAC name is 4-[2-(5-chloro-1H-indole-2-carbonyl)hydrazinyl]-N-[2-(dimethylamino)ethyl]-4-oxobutanamide.
| Compound Name | 4-[2-(5-chloro-1H-indole-2-carbonyl)hydrazinyl]-N-[2-(dimethylamino)ethyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 51362206 |
| Molecular Formula | C17H22ClN5O3 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 4-[2-(5-chloro-1H-indole-2-carbonyl)hydrazinyl]-N-[2-(dimethylamino)ethyl]-4-oxobutanamide |
| SMILES | CN(C)CCNC(=O)CCC(=O)NNC(=O)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C17H22ClN5O3/c1-23(2)8-7-19-15(24)5-6-16(25)21-22-17(26)14-10-11-9-12(18)3-4-13(11)20-14/h3-4,9-10,20H,5-8H2,1-2H3,(H,19,24)(H,21,25)(H,22,26) |
| InChIKey | HRYYNIZPFFPFGF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|