C23H32O4 — CID 5136629
(2,6,14,15-tetramethyl-5,7-dioxo-14-tetracyclo[8.7.0.02,6.011,15]heptadec-1(17)-enyl) acetate (PubChem CID 5136629) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is (2,6,14,15-tetramethyl-5,7-dioxo-14-tetracyclo[8.7.0.02,6.011,15]heptadec-1(17)-enyl) acetate.
| Compound Name | (2,6,14,15-tetramethyl-5,7-dioxo-14-tetracyclo[8.7.0.02,6.011,15]heptadec-1(17)-enyl) acetate |
|---|---|
| PubChem CID | 5136629 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (2,6,14,15-tetramethyl-5,7-dioxo-14-tetracyclo[8.7.0.02,6.011,15]heptadec-1(17)-enyl) acetate |
| SMILES | CC(=O)OC1(C)CCC2C3CCC(=O)C4(C)C(=O)CCC4(C)C3=CCC21C |
| InChI | InChI=1S/C23H32O4/c1-14(24)27-22(4)13-9-16-15-6-7-18(25)23(5)19(26)10-12-21(23,3)17(15)8-11-20(16,22)2/h8,15-16H,6-7,9-13H2,1-5H3 |
| InChIKey | NNHQNBHUTYESDN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|