C22H30O2 — CID 22213179
[(10S,13S,14S)-10,13,17-trimethyl-1,2,3,4,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 22213179) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is [(10S,13S,14S)-10,13,17-trimethyl-1,2,3,4,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(10S,13S,14S)-10,13,17-trimethyl-1,2,3,4,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 22213179 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | [(10S,13S,14S)-10,13,17-trimethyl-1,2,3,4,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)OC1(C)CC[C@H]2C3=CC=C4CCCC[C@]4(C)C3=CC[C@@]21C |
| InChI | InChI=1S/C22H30O2/c1-15(23)24-22(4)14-11-19-17-9-8-16-7-5-6-12-20(16,2)18(17)10-13-21(19,22)3/h8-10,19H,5-7,11-14H2,1-4H3/t19-,20-,21-,22?/m0/s1 |
| InChIKey | KVEFGSYQPVOCHZ-RQLHVLPXSA-N |
| XLogP | 5.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |