C18H24BrN5OS — CID 51391577
1-[[(2R)-3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylpropanoyl]amino]-3-(2,5-dimethylphenyl)thiourea (PubChem CID 51391577) has the molecular formula C18H24BrN5OS and a molecular weight of 438.40 g/mol. Its IUPAC name is 1-[[(2R)-3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylpropanoyl]amino]-3-(2,5-dimethylphenyl)thiourea.
| Compound Name | 1-[[(2R)-3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylpropanoyl]amino]-3-(2,5-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 51391577 |
| Molecular Formula | C18H24BrN5OS |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 1-[[(2R)-3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylpropanoyl]amino]-3-(2,5-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)NNC(=O)[C@H](C)Cn2nc(C)c(Br)c2C)c1 |
| InChI | InChI=1S/C18H24BrN5OS/c1-10-6-7-11(2)15(8-10)20-18(26)22-21-17(25)12(3)9-24-14(5)16(19)13(4)23-24/h6-8,12H,9H2,1-5H3,(H,21,25)(H2,20,22,26)/t12-/m1/s1 |
| InChIKey | QIERPYHMFGSNEF-GFCCVEGCSA-N |
| XLogP | 3.53 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|