C20H16N2O3S — CID 51450108
(10R,11R,15S,16R)-8-methyl-16-(thiophene-2-carbonyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione (PubChem CID 51450108) has the molecular formula C20H16N2O3S and a molecular weight of 364.43 g/mol. Its IUPAC name is (10R,11R,15S,16R)-8-methyl-16-(thiophene-2-carbonyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione.
| Compound Name | (10R,11R,15S,16R)-8-methyl-16-(thiophene-2-carbonyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
|---|---|
| PubChem CID | 51450108 |
| Molecular Formula | C20H16N2O3S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | (10R,11R,15S,16R)-8-methyl-16-(thiophene-2-carbonyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
| SMILES | CC1=C[C@@H]2[C@@H]3C(=O)NC(=O)[C@@H]3[C@H](C(=O)c3cccs3)N2c2ccccc21 |
| InChI | InChI=1S/C20H16N2O3S/c1-10-9-13-15-16(20(25)21-19(15)24)17(18(23)14-7-4-8-26-14)22(13)12-6-3-2-5-11(10)12/h2-9,13,15-17H,1H3,(H,21,24,25)/t13-,15+,16+,17-/m1/s1 |
| InChIKey | WTEMHUNGHRHHAV-BSWAZPDLSA-N |
| XLogP | 2.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|