C4H4Br2F4O — CID 51556798
(1S,2R)-1,2-dibromo-1,3,3,3-tetrafluoro-1-methoxypropane (PubChem CID 51556798) has the molecular formula C4H4Br2F4O and a molecular weight of 303.88 g/mol. Its IUPAC name is (1S,2R)-1,2-dibromo-1,3,3,3-tetrafluoro-1-methoxypropane.
| Compound Name | (1S,2R)-1,2-dibromo-1,3,3,3-tetrafluoro-1-methoxypropane |
|---|---|
| PubChem CID | 51556798 |
| Molecular Formula | C4H4Br2F4O |
| Molecular Weight | 303.88 g/mol |
| Exact Mass | 301.86 |
| IUPAC Name | (1S,2R)-1,2-dibromo-1,3,3,3-tetrafluoro-1-methoxypropane |
| SMILES | CO[C@@](F)(Br)[C@H](Br)C(F)(F)F |
| InChI | InChI=1S/C4H4Br2F4O/c1-11-3(6,7)2(5)4(8,9)10/h2H,1H3/t2-,3+/m0/s1 |
| InChIKey | PUPKPTWIRXQRGR-STHAYSLISA-N |
| XLogP | 2.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.88 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|