C27H29ClN4O — CID 5156564
[4-(3-chlorophenyl)piperazin-1-yl]-(12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaen-1-yl)methanone (PubChem CID 5156564) has the molecular formula C27H29ClN4O and a molecular weight of 461.01 g/mol. Its IUPAC name is [4-(3-chlorophenyl)piperazin-1-yl]-(12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaen-1-yl)methanone.
| Compound Name | [4-(3-chlorophenyl)piperazin-1-yl]-(12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaen-1-yl)methanone |
|---|---|
| PubChem CID | 5156564 |
| Molecular Formula | C27H29ClN4O |
| Molecular Weight | 461.01 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | [4-(3-chlorophenyl)piperazin-1-yl]-(12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaen-1-yl)methanone |
| SMILES | CC12CCC(C(=O)N3CCN(c4cccc(Cl)c4)CC3)(c3nc4ccccc4nc31)C2(C)C |
| InChI | InChI=1S/C27H29ClN4O/c1-25(2)26(3)11-12-27(25,23-22(26)29-20-9-4-5-10-21(20)30-23)24(33)32-15-13-31(14-16-32)19-8-6-7-18(28)17-19/h4-10,17H,11-16H2,1-3H3 |
| InChIKey | CFTJMUVIYPOMKI-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.01 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |