C27H28ClN5O3 — CID 5174640
[4-(3-chlorophenyl)piperazin-1-yl]-(12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaen-1-yl)methanone (PubChem CID 5174640) has the molecular formula C27H28ClN5O3 and a molecular weight of 506.01 g/mol. Its IUPAC name is [4-(3-chlorophenyl)piperazin-1-yl]-(12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaen-1-yl)methanone.
| Compound Name | [4-(3-chlorophenyl)piperazin-1-yl]-(12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaen-1-yl)methanone |
|---|---|
| PubChem CID | 5174640 |
| Molecular Formula | C27H28ClN5O3 |
| Molecular Weight | 506.01 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | [4-(3-chlorophenyl)piperazin-1-yl]-(12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaen-1-yl)methanone |
| SMILES | CC12CCC(C(=O)N3CCN(c4cccc(Cl)c4)CC3)(c3nc4cc([N+](=O)[O-])ccc4nc31)C2(C)C |
| InChI | InChI=1S/C27H28ClN5O3/c1-25(2)26(3)9-10-27(25,23-22(26)29-20-8-7-19(33(35)36)16-21(20)30-23)24(34)32-13-11-31(12-14-32)18-6-4-5-17(28)15-18/h4-8,15-16H,9-14H2,1-3H3 |
| InChIKey | DPDNQYGRLTWXGK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.01 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|