C18H19ClN2O2S — CID 51567883
N-[4-[(5S,7R)-3-chloro-1-adamantyl]-1,3-thiazol-2-yl]furan-2-carboxamide (PubChem CID 51567883) has the molecular formula C18H19ClN2O2S and a molecular weight of 362.88 g/mol. Its IUPAC name is N-[4-[(5S,7R)-3-chloro-1-adamantyl]-1,3-thiazol-2-yl]furan-2-carboxamide.
| Compound Name | N-[4-[(5S,7R)-3-chloro-1-adamantyl]-1,3-thiazol-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 51567883 |
| Molecular Formula | C18H19ClN2O2S |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | N-[4-[(5S,7R)-3-chloro-1-adamantyl]-1,3-thiazol-2-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1nc(C23C[C@@H]4C[C@@H](CC(Cl)(C4)C2)C3)cs1)c1ccco1 |
| InChI | InChI=1S/C18H19ClN2O2S/c19-18-7-11-4-12(8-18)6-17(5-11,10-18)14-9-24-16(20-14)21-15(22)13-2-1-3-23-13/h1-3,9,11-12H,4-8,10H2,(H,20,21,22)/t11-,12+,17?,18? |
| InChIKey | DTNJWCAQJQNSCX-CCHVVGMOSA-N |
| XLogP | 4.82 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|