C21H22N4O2 — CID 51570436
(3aR,7aR)-2-benzamido-N-phenyl-3a,4,5,6,7,7a-hexahydrobenzimidazole-1-carboxamide (PubChem CID 51570436) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is (3aR,7aR)-2-benzamido-N-phenyl-3a,4,5,6,7,7a-hexahydrobenzimidazole-1-carboxamide.
| Compound Name | (3aR,7aR)-2-benzamido-N-phenyl-3a,4,5,6,7,7a-hexahydrobenzimidazole-1-carboxamide |
|---|---|
| PubChem CID | 51570436 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (3aR,7aR)-2-benzamido-N-phenyl-3a,4,5,6,7,7a-hexahydrobenzimidazole-1-carboxamide |
| SMILES | O=C(NC1=N[C@@H]2CCCC[C@H]2N1C(=O)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H22N4O2/c26-19(15-9-3-1-4-10-15)24-20-23-17-13-7-8-14-18(17)25(20)21(27)22-16-11-5-2-6-12-16/h1-6,9-12,17-18H,7-8,13-14H2,(H,22,27)(H,23,24,26)/t17-,18-/m1/s1 |
| InChIKey | GZFWQNNKEHHSEK-QZTJIDSGSA-N |
| XLogP | 3.63 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |