C23H27N5O5 — CID 51580182
(3S)-3-[[1-(5-nitro-2-pyridinyl)piperidin-4-yl]amino]-1-(4-propoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 51580182) has the molecular formula C23H27N5O5 and a molecular weight of 453.50 g/mol. Its IUPAC name is (3S)-3-[[1-(5-nitro-2-pyridinyl)piperidin-4-yl]amino]-1-(4-propoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[[1-(5-nitro-2-pyridinyl)piperidin-4-yl]amino]-1-(4-propoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 51580182 |
| Molecular Formula | C23H27N5O5 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | (3S)-3-[[1-(5-nitro-2-pyridinyl)piperidin-4-yl]amino]-1-(4-propoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | CCCOc1ccc(N2C(=O)C[C@H](NC3CCN(c4ccc([N+](=O)[O-])cn4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C23H27N5O5/c1-2-13-33-19-6-3-17(4-7-19)27-22(29)14-20(23(27)30)25-16-9-11-26(12-10-16)21-8-5-18(15-24-21)28(31)32/h3-8,15-16,20,25H,2,9-14H2,1H3/t20-/m0/s1 |
| InChIKey | LLMCYTFTQPANLJ-FQEVSTJZSA-N |
| XLogP | 2.67 |
| TPSA | 117.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|