C24H32N2O4 — CID 51583973
[(5R)-5-tert-butyl-4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl]-[(2S)-2-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]methanone (PubChem CID 51583973) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is [(5R)-5-tert-butyl-4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl]-[(2S)-2-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]methanone.
| Compound Name | [(5R)-5-tert-butyl-4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl]-[(2S)-2-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 51583973 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | [(5R)-5-tert-butyl-4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl]-[(2S)-2-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]methanone |
| SMILES | COc1ccc([C@@H]2CCCN2C(=O)c2noc3c2C[C@H](C(C)(C)C)CC3)cc1OC |
| InChI | InChI=1S/C24H32N2O4/c1-24(2,3)16-9-11-19-17(14-16)22(25-30-19)23(27)26-12-6-7-18(26)15-8-10-20(28-4)21(13-15)29-5/h8,10,13,16,18H,6-7,9,11-12,14H2,1-5H3/t16-,18+/m1/s1 |
| InChIKey | WASXPIOWNTWMBQ-AEFFLSMTSA-N |
| XLogP | 4.82 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |