C19H20F2N2O3S — CID 51588786
(1R,5S)-3-(3-fluorophenyl)sulfonyl-9-(2-fluoro-3-pyridinyl)-3-azabicyclo[3.3.1]nonan-9-ol (PubChem CID 51588786) has the molecular formula C19H20F2N2O3S and a molecular weight of 394.44 g/mol. Its IUPAC name is (1R,5S)-3-(3-fluorophenyl)sulfonyl-9-(2-fluoro-3-pyridinyl)-3-azabicyclo[3.3.1]nonan-9-ol.
| Compound Name | (1R,5S)-3-(3-fluorophenyl)sulfonyl-9-(2-fluoro-3-pyridinyl)-3-azabicyclo[3.3.1]nonan-9-ol |
|---|---|
| PubChem CID | 51588786 |
| Molecular Formula | C19H20F2N2O3S |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (1R,5S)-3-(3-fluorophenyl)sulfonyl-9-(2-fluoro-3-pyridinyl)-3-azabicyclo[3.3.1]nonan-9-ol |
| SMILES | O=S(=O)(c1cccc(F)c1)N1C[C@H]2CCC[C@@H](C1)C2(O)c1cccnc1F |
| InChI | InChI=1S/C19H20F2N2O3S/c20-15-6-2-7-16(10-15)27(25,26)23-11-13-4-1-5-14(12-23)19(13,24)17-8-3-9-22-18(17)21/h2-3,6-10,13-14,24H,1,4-5,11-12H2/t13-,14+,19? |
| InChIKey | QDGMJJVVOBVCDB-FSWDVZBNSA-N |
| XLogP | 2.67 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|