C25H27NO3 — CID 51590172
(1R,2R,4R)-N-[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-phenylpropyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 51590172) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is (1R,2R,4R)-N-[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-phenylpropyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2R,4R)-N-[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-phenylpropyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 51590172 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | (1R,2R,4R)-N-[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-phenylpropyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | O=C(N[C@@H](CCc1ccccc1)c1ccc2c(c1)OCCO2)[C@@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C25H27NO3/c27-25(21-15-18-6-8-19(21)14-18)26-22(10-7-17-4-2-1-3-5-17)20-9-11-23-24(16-20)29-13-12-28-23/h1-6,8-9,11,16,18-19,21-22H,7,10,12-15H2,(H,26,27)/t18-,19+,21-,22+/m1/s1 |
| InChIKey | RWBIISKQZWQBNJ-KIZRIRGWSA-N |
| XLogP | 4.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|