C14H21N2O10-3 — CID 51590996
2-[2-[2-[2-[bis(carboxylatomethyl)amino]ethoxy]ethoxy]ethyl-(carboxylatomethyl)azaniumyl]acetate (PubChem CID 51590996) has the molecular formula C14H21N2O10-3 and a molecular weight of 377.33 g/mol. Its IUPAC name is 2-[2-[2-[2-[bis(carboxylatomethyl)amino]ethoxy]ethoxy]ethyl-(carboxylatomethyl)azaniumyl]acetate.
| Compound Name | 2-[2-[2-[2-[bis(carboxylatomethyl)amino]ethoxy]ethoxy]ethyl-(carboxylatomethyl)azaniumyl]acetate |
|---|---|
| PubChem CID | 51590996 |
| Molecular Formula | C14H21N2O10-3 |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 2-[2-[2-[2-[bis(carboxylatomethyl)amino]ethoxy]ethoxy]ethyl-(carboxylatomethyl)azaniumyl]acetate |
| SMILES | O=C([O-])CN(CCOCCOCC[NH+](CC(=O)[O-])CC(=O)[O-])CC(=O)[O-] |
| InChI | InChI=1S/C14H24N2O10/c17-11(18)7-15(8-12(19)20)1-3-25-5-6-26-4-2-16(9-13(21)22)10-14(23)24/h1-10H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24)/p-3 |
| InChIKey | DEFVIWRASFVYLL-UHFFFAOYSA-K |
| XLogP | -8.79 |
| TPSA | 186.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | -8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|