C10H13N2O8-3 — CID 25201827
2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)azaniumyl]acetate (PubChem CID 25201827) has the molecular formula C10H13N2O8-3 and a molecular weight of 289.22 g/mol. Its IUPAC name is 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)azaniumyl]acetate.
| Compound Name | 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)azaniumyl]acetate |
|---|---|
| PubChem CID | 25201827 |
| Molecular Formula | C10H13N2O8-3 |
| Molecular Weight | 289.22 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)azaniumyl]acetate |
| SMILES | O=C([O-])CN(CC[NH+](CC(=O)[O-])CC(=O)[O-])CC(=O)[O-] |
| InChI | InChI=1S/C10H16N2O8/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20)/p-3 |
| InChIKey | KCXVZYZYPLLWCC-UHFFFAOYSA-K |
| XLogP | -8.83 |
| TPSA | 168.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.22 |
| LogP ≤ 5 | -8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |