C20H21N5O2 — CID 51595613
(2-ethoxy-3-pyridinyl)-[(1S,12R)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]methanone (PubChem CID 51595613) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is (2-ethoxy-3-pyridinyl)-[(1S,12R)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]methanone.
| Compound Name | (2-ethoxy-3-pyridinyl)-[(1S,12R)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]methanone |
|---|---|
| PubChem CID | 51595613 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | (2-ethoxy-3-pyridinyl)-[(1S,12R)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]methanone |
| SMILES | CCOc1ncccc1C(=O)N1[C@@H]2CC[C@H]1c1cnc3cc(C)nn3c1C2 |
| InChI | InChI=1S/C20H21N5O2/c1-3-27-19-14(5-4-8-21-19)20(26)24-13-6-7-16(24)15-11-22-18-9-12(2)23-25(18)17(15)10-13/h4-5,8-9,11,13,16H,3,6-7,10H2,1-2H3/t13-,16+/m1/s1 |
| InChIKey | JOVMJIMAHAOMHT-CJNGLKHVSA-N |
| XLogP | 2.73 |
| TPSA | 72.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |