C19H19N5O — CID 98062382
1-[(1R,12R)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]-2-pyridin-3-ylethanone (PubChem CID 98062382) has the molecular formula C19H19N5O and a molecular weight of 333.39 g/mol. Its IUPAC name is 1-[(1R,12R)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]-2-pyridin-3-ylethanone.
| Compound Name | 1-[(1R,12R)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]-2-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 98062382 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 1-[(1R,12R)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]-2-pyridin-3-ylethanone |
| SMILES | Cc1cc2ncc3c(n2n1)C[C@H]1CC[C@H]3N1C(=O)Cc1cccnc1 |
| InChI | InChI=1S/C19H19N5O/c1-12-7-18-21-11-15-16-5-4-14(9-17(15)24(18)22-12)23(16)19(25)8-13-3-2-6-20-10-13/h2-3,6-7,10-11,14,16H,4-5,8-9H2,1H3/t14-,16-/m1/s1 |
| InChIKey | IGBFWFGWYNUUGR-GDBMZVCRSA-N |
| XLogP | 2.26 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |