C17H18N4O — CID 98077871
(1S,12S)-15-(furan-3-ylmethyl)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene (PubChem CID 98077871) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is (1S,12S)-15-(furan-3-ylmethyl)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene.
| Compound Name | (1S,12S)-15-(furan-3-ylmethyl)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene |
|---|---|
| PubChem CID | 98077871 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (1S,12S)-15-(furan-3-ylmethyl)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene |
| SMILES | Cc1cc2ncc3c(n2n1)C[C@@H]1CC[C@@H]3N1Cc1ccoc1 |
| InChI | InChI=1S/C17H18N4O/c1-11-6-17-18-8-14-15-3-2-13(7-16(14)21(17)19-11)20(15)9-12-4-5-22-10-12/h4-6,8,10,13,15H,2-3,7,9H2,1H3/t13-,15-/m0/s1 |
| InChIKey | KFDPDUXYHQOMHA-ZFWWWQNUSA-N |
| XLogP | 2.89 |
| TPSA | 46.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |